About (Z)-but-2-enedioate;bis(triethyl(methyl)azanium)
(Z)-but-2-enedioate;bis(triethyl(methyl)azanium) (PubChem CID 86743662) has the molecular formula C18H38N2O4
and a molecular weight of 346.51 g/mol. Its IUPAC name is (Z)-but-2-enedioate;bis(triethyl(methyl)azanium).
Molecular Properties
| Compound Name | (Z)-but-2-enedioate;bis(triethyl(methyl)azanium) |
| PubChem CID | 86743662 |
| Molecular Formula | C18H38N2O4 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.28 |
| IUPAC Name | (Z)-but-2-enedioate;bis(triethyl(methyl)azanium) |
| SMILES | CC[N+](C)(CC)CC.CC[N+](C)(CC)CC.O=C([O-])/C=C\C(=O)[O-] |
| InChI | InChI=1S/2C7H18N.C4H4O4/c2*1-5-8(4,6-2)7-3;5-3(6)1-2-4(7)8/h2*5-7H2,1-4H3;1-2H,(H,5,6)(H,7,8)/q2*+1;/p-2/b;;2-1- |
| InChIKey | KKUHGGZTINWROK-KSBRXOFISA-L |
| XLogP | 0.03 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedioate;bis(triethyl(methyl)azanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedioate;bis(triethyl(methyl)azanium)?
The IUPAC name of (Z)-but-2-enedioate;bis(triethyl(methyl)azanium) (CID 86743662) is (Z)-but-2-enedioate;bis(triethyl(methyl)azanium).
What is the SMILES notation for (Z)-but-2-enedioate;bis(triethyl(methyl)azanium)?
The canonical SMILES for (Z)-but-2-enedioate;bis(triethyl(methyl)azanium) is CC[N+](C)(CC)CC.CC[N+](C)(CC)CC.O=C([O-])/C=C\C(=O)[O-].
What is the InChIKey of (Z)-but-2-enedioate;bis(triethyl(methyl)azanium)?
The InChIKey is KKUHGGZTINWROK-KSBRXOFISA-L. The full InChI is InChI=1S/2C7H18N.C4H4O4/c2*1-5-8(4,6-2)7-3;5-3(6)1-2-4(7)8/h2*5-7H2,1-4H3;1-2H,(H,5,6)(H,7,8)/q2*+1;/p-2/b;;2-1-.
What are the key properties of (Z)-but-2-enedioate;bis(triethyl(methyl)azanium)?
(Z)-but-2-enedioate;bis(triethyl(methyl)azanium) has a molecular weight of 346.51 g/mol, XLogP of 0.03, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedioate;bis(triethyl(methyl)azanium) is sourced from PubChem (CID 86743662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).