C17H36Cl2N2O4 — CID 175220042
2,2-dichloropropanedioate;bis(triethyl(methyl)azanium) (PubChem CID 175220042) has the molecular formula C17H36Cl2N2O4 and a molecular weight of 403.39 g/mol. Its IUPAC name is 2,2-dichloropropanedioate;bis(triethyl(methyl)azanium).
| Compound Name | 2,2-dichloropropanedioate;bis(triethyl(methyl)azanium) |
|---|---|
| PubChem CID | 175220042 |
| Molecular Formula | C17H36Cl2N2O4 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 2,2-dichloropropanedioate;bis(triethyl(methyl)azanium) |
| SMILES | CC[N+](C)(CC)CC.CC[N+](C)(CC)CC.O=C([O-])C(Cl)(Cl)C(=O)[O-] |
| InChI | InChI=1S/2C7H18N.C3H2Cl2O4/c2*1-5-8(4,6-2)7-3;4-3(5,1(6)7)2(8)9/h2*5-7H2,1-4H3;(H,6,7)(H,8,9)/q2*+1;/p-2 |
| InChIKey | JLXJWWKJRGEREX-UHFFFAOYSA-L |
| XLogP | 0.65 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|