C16H35NO2 — CID 87375681
2,2-diethylbutanoate;tetraethylazanium (PubChem CID 87375681) has the molecular formula C16H35NO2 and a molecular weight of 273.46 g/mol. Its IUPAC name is 2,2-diethylbutanoate;tetraethylazanium.
| Compound Name | 2,2-diethylbutanoate;tetraethylazanium |
|---|---|
| PubChem CID | 87375681 |
| Molecular Formula | C16H35NO2 |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.27 |
| IUPAC Name | 2,2-diethylbutanoate;tetraethylazanium |
| SMILES | CCC(CC)(CC)C(=O)[O-].CC[N+](CC)(CC)CC |
| InChI | InChI=1S/C8H20N.C8H16O2/c1-5-9(6-2,7-3)8-4;1-4-8(5-2,6-3)7(9)10/h5-8H2,1-4H3;4-6H2,1-3H3,(H,9,10)/q+1;/p-1 |
| InChIKey | VWDWYAIVQGOEEH-UHFFFAOYSA-M |
| XLogP | 2.84 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|