C20H41Cl3N2O6 — CID 142704618
2,3-dichloro-2-chlorooxy-3-hydroxybutanedioate;bis(tetraethylazanium) (PubChem CID 142704618) has the molecular formula C20H41Cl3N2O6 and a molecular weight of 511.92 g/mol. Its IUPAC name is 2,3-dichloro-2-chlorooxy-3-hydroxybutanedioate;bis(tetraethylazanium).
| Compound Name | 2,3-dichloro-2-chlorooxy-3-hydroxybutanedioate;bis(tetraethylazanium) |
|---|---|
| PubChem CID | 142704618 |
| Molecular Formula | C20H41Cl3N2O6 |
| Molecular Weight | 511.92 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | 2,3-dichloro-2-chlorooxy-3-hydroxybutanedioate;bis(tetraethylazanium) |
| SMILES | CC[N+](CC)(CC)CC.CC[N+](CC)(CC)CC.O=C([O-])C(O)(Cl)C(Cl)(OCl)C(=O)[O-] |
| InChI | InChI=1S/2C8H20N.C4H3Cl3O6/c2*1-5-9(6-2,7-3)8-4;5-3(12,1(8)9)4(6,13-7)2(10)11/h2*5-8H2,1-4H3;12H,(H,8,9)(H,10,11)/q2*+1;/p-2 |
| InChIKey | SGJGWTWYTAPOAY-UHFFFAOYSA-L |
| XLogP | 1.28 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.92 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|