C6H5Cl4O2- — CID 23372420
(Z)-3,4,4,4-tetrachloro-2-ethylbut-2-enoate (PubChem CID 23372420) has the molecular formula C6H5Cl4O2- and a molecular weight of 250.92 g/mol. Its IUPAC name is (Z)-3,4,4,4-tetrachloro-2-ethylbut-2-enoate.
| Compound Name | (Z)-3,4,4,4-tetrachloro-2-ethylbut-2-enoate |
|---|---|
| PubChem CID | 23372420 |
| Molecular Formula | C6H5Cl4O2- |
| Molecular Weight | 250.92 g/mol |
| Exact Mass | 248.90 |
| IUPAC Name | (Z)-3,4,4,4-tetrachloro-2-ethylbut-2-enoate |
| SMILES | CC/C(C(=O)[O-])=C(/Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H6Cl4O2/c1-2-3(5(11)12)4(7)6(8,9)10/h2H2,1H3,(H,11,12)/p-1/b4-3- |
| InChIKey | RKWWZJAMEPDSIL-ARJAWSKDSA-M |
| XLogP | 2.01 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.92 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|