About 2-ethyl-3-(3-ethyloctan-3-yl)but-2-enedioate;lead(2+)
2-ethyl-3-(3-ethyloctan-3-yl)but-2-enedioate;lead(2+) (PubChem CID 173460771) has the molecular formula C16H26O4Pb
and a molecular weight of 489.58 g/mol. Its IUPAC name is 2-ethyl-3-(3-ethyloctan-3-yl)but-2-enedioate;lead(2+).
Molecular Properties
| Compound Name | 2-ethyl-3-(3-ethyloctan-3-yl)but-2-enedioate;lead(2+) |
| PubChem CID | 173460771 |
| Molecular Formula | C16H26O4Pb |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 2-ethyl-3-(3-ethyloctan-3-yl)but-2-enedioate;lead(2+) |
| SMILES | CCCCCC(CC)(CC)C(C(=O)[O-])=C(CC)C(=O)[O-].[Pb+2] |
| InChI | InChI=1S/C16H28O4.Pb/c1-5-9-10-11-16(7-3,8-4)13(15(19)20)12(6-2)14(17)18;/h5-11H2,1-4H3,(H,17,18)(H,19,20);/q;+2/p-2 |
| InChIKey | VJLOQKIIOVVDSR-UHFFFAOYSA-L |
| XLogP | 1.20 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-3-(3-ethyloctan-3-yl)but-2-enedioate;lead(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-(3-ethyloctan-3-yl)but-2-enedioate;lead(2+)?
The IUPAC name of 2-ethyl-3-(3-ethyloctan-3-yl)but-2-enedioate;lead(2+) (CID 173460771) is 2-ethyl-3-(3-ethyloctan-3-yl)but-2-enedioate;lead(2+).
What is the SMILES notation for 2-ethyl-3-(3-ethyloctan-3-yl)but-2-enedioate;lead(2+)?
The canonical SMILES for 2-ethyl-3-(3-ethyloctan-3-yl)but-2-enedioate;lead(2+) is CCCCCC(CC)(CC)C(C(=O)[O-])=C(CC)C(=O)[O-].[Pb+2].
What is the InChIKey of 2-ethyl-3-(3-ethyloctan-3-yl)but-2-enedioate;lead(2+)?
The InChIKey is VJLOQKIIOVVDSR-UHFFFAOYSA-L. The full InChI is InChI=1S/C16H28O4.Pb/c1-5-9-10-11-16(7-3,8-4)13(15(19)20)12(6-2)14(17)18;/h5-11H2,1-4H3,(H,17,18)(H,19,20);/q;+2/p-2.
What are the key properties of 2-ethyl-3-(3-ethyloctan-3-yl)but-2-enedioate;lead(2+)?
2-ethyl-3-(3-ethyloctan-3-yl)but-2-enedioate;lead(2+) has a molecular weight of 489.58 g/mol, XLogP of 1.20, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-(3-ethyloctan-3-yl)but-2-enedioate;lead(2+) is sourced from PubChem (CID 173460771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).