C8H12Na2O4 — CID 87651359
disodium;2,2-diethylbutanedioate (PubChem CID 87651359) has the molecular formula C8H12Na2O4 and a molecular weight of 218.16 g/mol. Its IUPAC name is disodium;2,2-diethylbutanedioate.
| Compound Name | disodium;2,2-diethylbutanedioate |
|---|---|
| PubChem CID | 87651359 |
| Molecular Formula | C8H12Na2O4 |
| Molecular Weight | 218.16 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | disodium;2,2-diethylbutanedioate |
| SMILES | CCC(CC)(CC(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C8H14O4.2Na/c1-3-8(4-2,7(11)12)5-6(9)10;;/h3-5H2,1-2H3,(H,9,10)(H,11,12);;/q;2*+1/p-2 |
| InChIKey | AWTKCSFMFSWCEN-UHFFFAOYSA-L |
| XLogP | -7.31 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.16 |
| LogP ≤ 5 | -7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |