About perchloric acid;triethyl(methyl)azanium
perchloric acid;triethyl(methyl)azanium (PubChem CID 87764447) has the molecular formula C7H19ClNO4+
and a molecular weight of 216.68 g/mol. Its IUPAC name is perchloric acid;triethyl(methyl)azanium.
Molecular Properties
| Compound Name | perchloric acid;triethyl(methyl)azanium |
| PubChem CID | 87764447 |
| Molecular Formula | C7H19ClNO4+ |
| Molecular Weight | 216.68 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | perchloric acid;triethyl(methyl)azanium |
| SMILES | CC[N+](C)(CC)CC.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C7H18N.ClHO4/c1-5-8(4,6-2)7-3;2-1(3,4)5/h5-7H2,1-4H3;(H,2,3,4,5)/q+1; |
| InChIKey | BLRMUYHDGZLDLY-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 89.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.68 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze perchloric acid;triethyl(methyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of perchloric acid;triethyl(methyl)azanium?
The IUPAC name of perchloric acid;triethyl(methyl)azanium (CID 87764447) is perchloric acid;triethyl(methyl)azanium.
What is the SMILES notation for perchloric acid;triethyl(methyl)azanium?
The canonical SMILES for perchloric acid;triethyl(methyl)azanium is CC[N+](C)(CC)CC.[O-][Cl+3]([O-])([O-])O.
What is the InChIKey of perchloric acid;triethyl(methyl)azanium?
The InChIKey is BLRMUYHDGZLDLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N.ClHO4/c1-5-8(4,6-2)7-3;2-1(3,4)5/h5-7H2,1-4H3;(H,2,3,4,5)/q+1;.
What are the key properties of perchloric acid;triethyl(methyl)azanium?
perchloric acid;triethyl(methyl)azanium has a molecular weight of 216.68 g/mol, XLogP of -2.63, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for perchloric acid;triethyl(methyl)azanium is sourced from PubChem (CID 87764447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).