About triethyl(methyl)azanium iodate
triethyl(methyl)azanium iodate (PubChem CID 158535675) has the molecular formula C7H18INO3
and a molecular weight of 291.13 g/mol. Its IUPAC name is triethyl(methyl)azanium iodate.
Molecular Properties
| Compound Name | triethyl(methyl)azanium iodate |
| PubChem CID | 158535675 |
| Molecular Formula | C7H18INO3 |
| Molecular Weight | 291.13 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | triethyl(methyl)azanium iodate |
| SMILES | CC[N+](C)(CC)CC.[O-][I+2]([O-])[O-] |
| InChI | InChI=1S/C7H18N.IO3/c1-5-8(4,6-2)7-3;2-1(3)4/h5-7H2,1-4H3;/q+1;-1 |
| InChIKey | CTGBVMKBOPWXMM-UHFFFAOYSA-N |
| XLogP | -5.07 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.13 |
| LogP ≤ 5 | -5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze triethyl(methyl)azanium iodate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl(methyl)azanium iodate?
The IUPAC name of triethyl(methyl)azanium iodate (CID 158535675) is triethyl(methyl)azanium iodate.
What is the SMILES notation for triethyl(methyl)azanium iodate?
The canonical SMILES for triethyl(methyl)azanium iodate is CC[N+](C)(CC)CC.[O-][I+2]([O-])[O-].
What is the InChIKey of triethyl(methyl)azanium iodate?
The InChIKey is CTGBVMKBOPWXMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N.IO3/c1-5-8(4,6-2)7-3;2-1(3)4/h5-7H2,1-4H3;/q+1;-1.
What are the key properties of triethyl(methyl)azanium iodate?
triethyl(methyl)azanium iodate has a molecular weight of 291.13 g/mol, XLogP of -5.07, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl(methyl)azanium iodate is sourced from PubChem (CID 158535675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).