About ethyl sulfate;triethyl(methyl)azanium
ethyl sulfate;triethyl(methyl)azanium (PubChem CID 118676380) has the molecular formula C9H23NO4S
and a molecular weight of 241.35 g/mol. Its IUPAC name is ethyl sulfate;triethyl(methyl)azanium.
Molecular Properties
| Compound Name | ethyl sulfate;triethyl(methyl)azanium |
| PubChem CID | 118676380 |
| Molecular Formula | C9H23NO4S |
| Molecular Weight | 241.35 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | ethyl sulfate;triethyl(methyl)azanium |
| SMILES | CCOS(=O)(=O)[O-].CC[N+](C)(CC)CC |
| InChI | InChI=1S/C7H18N.C2H6O4S/c1-5-8(4,6-2)7-3;1-2-6-7(3,4)5/h5-7H2,1-4H3;2H2,1H3,(H,3,4,5)/q+1;/p-1 |
| InChIKey | VIWITNDPERGLKX-UHFFFAOYSA-M |
| XLogP | 0.98 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze ethyl sulfate;triethyl(methyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl sulfate;triethyl(methyl)azanium?
The IUPAC name of ethyl sulfate;triethyl(methyl)azanium (CID 118676380) is ethyl sulfate;triethyl(methyl)azanium.
What is the SMILES notation for ethyl sulfate;triethyl(methyl)azanium?
The canonical SMILES for ethyl sulfate;triethyl(methyl)azanium is CCOS(=O)(=O)[O-].CC[N+](C)(CC)CC.
What is the InChIKey of ethyl sulfate;triethyl(methyl)azanium?
The InChIKey is VIWITNDPERGLKX-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H18N.C2H6O4S/c1-5-8(4,6-2)7-3;1-2-6-7(3,4)5/h5-7H2,1-4H3;2H2,1H3,(H,3,4,5)/q+1;/p-1.
What are the key properties of ethyl sulfate;triethyl(methyl)azanium?
ethyl sulfate;triethyl(methyl)azanium has a molecular weight of 241.35 g/mol, XLogP of 0.98, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl sulfate;triethyl(methyl)azanium is sourced from PubChem (CID 118676380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).