About 2-acetyloxyethyl(trimethyl)azanium;ethyl sulfate
2-acetyloxyethyl(trimethyl)azanium;ethyl sulfate (PubChem CID 135203453) has the molecular formula C9H21NO6S
and a molecular weight of 271.33 g/mol. Its IUPAC name is 2-acetyloxyethyl(trimethyl)azanium;ethyl sulfate.
Molecular Properties
| Compound Name | 2-acetyloxyethyl(trimethyl)azanium;ethyl sulfate |
| PubChem CID | 135203453 |
| Molecular Formula | C9H21NO6S |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 2-acetyloxyethyl(trimethyl)azanium;ethyl sulfate |
| SMILES | CC(=O)OCC[N+](C)(C)C.CCOS(=O)(=O)[O-] |
| InChI | InChI=1S/C7H16NO2.C2H6O4S/c1-7(9)10-6-5-8(2,3)4;1-2-6-7(3,4)5/h5-6H2,1-4H3;2H2,1H3,(H,3,4,5)/q+1;/p-1 |
| InChIKey | LDZXGSFSNNNWIZ-UHFFFAOYSA-M |
| XLogP | -0.26 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyloxyethyl(trimethyl)azanium;ethyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyloxyethyl(trimethyl)azanium;ethyl sulfate?
The IUPAC name of 2-acetyloxyethyl(trimethyl)azanium;ethyl sulfate (CID 135203453) is 2-acetyloxyethyl(trimethyl)azanium;ethyl sulfate.
What is the SMILES notation for 2-acetyloxyethyl(trimethyl)azanium;ethyl sulfate?
The canonical SMILES for 2-acetyloxyethyl(trimethyl)azanium;ethyl sulfate is CC(=O)OCC[N+](C)(C)C.CCOS(=O)(=O)[O-].
What is the InChIKey of 2-acetyloxyethyl(trimethyl)azanium;ethyl sulfate?
The InChIKey is LDZXGSFSNNNWIZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H16NO2.C2H6O4S/c1-7(9)10-6-5-8(2,3)4;1-2-6-7(3,4)5/h5-6H2,1-4H3;2H2,1H3,(H,3,4,5)/q+1;/p-1.
What are the key properties of 2-acetyloxyethyl(trimethyl)azanium;ethyl sulfate?
2-acetyloxyethyl(trimethyl)azanium;ethyl sulfate has a molecular weight of 271.33 g/mol, XLogP of -0.26, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxyethyl(trimethyl)azanium;ethyl sulfate is sourced from PubChem (CID 135203453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).