C11H25NO4S2 — CID 175702679
ethyl-methyl-bis(prop-2-enyl)azanium;ethyl sulfate;sulfane (PubChem CID 175702679) has the molecular formula C11H25NO4S2 and a molecular weight of 299.46 g/mol. Its IUPAC name is ethyl-methyl-bis(prop-2-enyl)azanium;ethyl sulfate;sulfane.
| Compound Name | ethyl-methyl-bis(prop-2-enyl)azanium;ethyl sulfate;sulfane |
|---|---|
| PubChem CID | 175702679 |
| Molecular Formula | C11H25NO4S2 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | ethyl-methyl-bis(prop-2-enyl)azanium;ethyl sulfate;sulfane |
| SMILES | C=CC[N+](C)(CC)CC=C.CCOS(=O)(=O)[O-].S |
| InChI | InChI=1S/C9H18N.C2H6O4S.H2S/c1-5-8-10(4,7-3)9-6-2;1-2-6-7(3,4)5;/h5-6H,1-2,7-9H2,3-4H3;2H2,1H3,(H,3,4,5);1H2/q+1;;/p-1 |
| InChIKey | XNAFLQCMFHGSQX-UHFFFAOYSA-M |
| XLogP | 1.42 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|