C17H42N2O8S2 — CID 89422341
ethyl-[5-[ethyl(dimethyl)azaniumyl]pentyl]-dimethylazanium;ethyl sulfate (PubChem CID 89422341) has the molecular formula C17H42N2O8S2 and a molecular weight of 466.66 g/mol. Its IUPAC name is ethyl-[5-[ethyl(dimethyl)azaniumyl]pentyl]-dimethylazanium;ethyl sulfate.
| Compound Name | ethyl-[5-[ethyl(dimethyl)azaniumyl]pentyl]-dimethylazanium;ethyl sulfate |
|---|---|
| PubChem CID | 89422341 |
| Molecular Formula | C17H42N2O8S2 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | ethyl-[5-[ethyl(dimethyl)azaniumyl]pentyl]-dimethylazanium;ethyl sulfate |
| SMILES | CCOS(=O)(=O)[O-].CCOS(=O)(=O)[O-].CC[N+](C)(C)CCCCC[N+](C)(C)CC |
| InChI | InChI=1S/C13H32N2.2C2H6O4S/c1-7-14(3,4)12-10-9-11-13-15(5,6)8-2;2*1-2-6-7(3,4)5/h7-13H2,1-6H3;2*2H2,1H3,(H,3,4,5)/q+2;;/p-2 |
| InChIKey | SUGQOBPDRGRZKZ-UHFFFAOYSA-L |
| XLogP | 1.32 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|