C16H35NO5S — CID 159488918
ethyl-dimethyl-(8-methyl-5-oxononyl)azanium;ethyl sulfate (PubChem CID 159488918) has the molecular formula C16H35NO5S and a molecular weight of 353.53 g/mol. Its IUPAC name is ethyl-dimethyl-(8-methyl-5-oxononyl)azanium;ethyl sulfate.
| Compound Name | ethyl-dimethyl-(8-methyl-5-oxononyl)azanium;ethyl sulfate |
|---|---|
| PubChem CID | 159488918 |
| Molecular Formula | C16H35NO5S |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | ethyl-dimethyl-(8-methyl-5-oxononyl)azanium;ethyl sulfate |
| SMILES | CCOS(=O)(=O)[O-].CC[N+](C)(C)CCCCC(=O)CCC(C)C |
| InChI | InChI=1S/C14H30NO.C2H6O4S/c1-6-15(4,5)12-8-7-9-14(16)11-10-13(2)3;1-2-6-7(3,4)5/h13H,6-12H2,1-5H3;2H2,1H3,(H,3,4,5)/q+1;/p-1 |
| InChIKey | QDDKNHATTFXGFC-UHFFFAOYSA-M |
| XLogP | 2.74 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|