C18H40N2O5S — CID 175124399
ethyl-methyl-[(7-methyloctanoylamino)methyl]-propylazanium;ethyl sulfate (PubChem CID 175124399) has the molecular formula C18H40N2O5S and a molecular weight of 396.59 g/mol. Its IUPAC name is ethyl-methyl-[(7-methyloctanoylamino)methyl]-propylazanium;ethyl sulfate.
| Compound Name | ethyl-methyl-[(7-methyloctanoylamino)methyl]-propylazanium;ethyl sulfate |
|---|---|
| PubChem CID | 175124399 |
| Molecular Formula | C18H40N2O5S |
| Molecular Weight | 396.59 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | ethyl-methyl-[(7-methyloctanoylamino)methyl]-propylazanium;ethyl sulfate |
| SMILES | CCC[N+](C)(CC)CNC(=O)CCCCCC(C)C.CCOS(=O)(=O)[O-] |
| InChI | InChI=1S/C16H34N2O.C2H6O4S/c1-6-13-18(5,7-2)14-17-16(19)12-10-8-9-11-15(3)4;1-2-6-7(3,4)5/h15H,6-14H2,1-5H3;2H2,1H3,(H,3,4,5) |
| InChIKey | UDDNXCIYZSPGKX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.59 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|