C13H27NO6S — CID 87985729
ethyl sulfate;triethyl(1-prop-2-enoyloxyethyl)azanium (PubChem CID 87985729) has the molecular formula C13H27NO6S and a molecular weight of 325.43 g/mol. Its IUPAC name is ethyl sulfate;triethyl(1-prop-2-enoyloxyethyl)azanium.
| Compound Name | ethyl sulfate;triethyl(1-prop-2-enoyloxyethyl)azanium |
|---|---|
| PubChem CID | 87985729 |
| Molecular Formula | C13H27NO6S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | ethyl sulfate;triethyl(1-prop-2-enoyloxyethyl)azanium |
| SMILES | C=CC(=O)OC(C)[N+](CC)(CC)CC.CCOS(=O)(=O)[O-] |
| InChI | InChI=1S/C11H22NO2.C2H6O4S/c1-6-11(13)14-10(5)12(7-2,8-3)9-4;1-2-6-7(3,4)5/h6,10H,1,7-9H2,2-5H3;2H2,1H3,(H,3,4,5)/q+1;/p-1 |
| InChIKey | JOECGLBGTPSELK-UHFFFAOYSA-M |
| XLogP | 1.42 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|