About hydron;triethyl(methyl)azanium;tetrafluoroborate
hydron;triethyl(methyl)azanium;tetrafluoroborate (PubChem CID 87302670) has the molecular formula C7H19BF4N+
and a molecular weight of 204.04 g/mol. Its IUPAC name is hydron;triethyl(methyl)azanium;tetrafluoroborate.
Molecular Properties
| Compound Name | hydron;triethyl(methyl)azanium;tetrafluoroborate |
| PubChem CID | 87302670 |
| Molecular Formula | C7H19BF4N+ |
| Molecular Weight | 204.04 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | hydron;triethyl(methyl)azanium;tetrafluoroborate |
| SMILES | CC[N+](C)(CC)CC.F[B-](F)(F)F.[H+] |
| InChI | InChI=1S/C7H18N.BF4/c1-5-8(4,6-2)7-3;2-1(3,4)5/h5-7H2,1-4H3;/q+1;-1/p+1 |
| InChIKey | OHZMHURLSZDGTO-UHFFFAOYSA-O |
| XLogP | 2.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.04 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze hydron;triethyl(methyl)azanium;tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;triethyl(methyl)azanium;tetrafluoroborate?
The IUPAC name of hydron;triethyl(methyl)azanium;tetrafluoroborate (CID 87302670) is hydron;triethyl(methyl)azanium;tetrafluoroborate.
What is the SMILES notation for hydron;triethyl(methyl)azanium;tetrafluoroborate?
The canonical SMILES for hydron;triethyl(methyl)azanium;tetrafluoroborate is CC[N+](C)(CC)CC.F[B-](F)(F)F.[H+].
What is the InChIKey of hydron;triethyl(methyl)azanium;tetrafluoroborate?
The InChIKey is OHZMHURLSZDGTO-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H18N.BF4/c1-5-8(4,6-2)7-3;2-1(3,4)5/h5-7H2,1-4H3;/q+1;-1/p+1.
What are the key properties of hydron;triethyl(methyl)azanium;tetrafluoroborate?
hydron;triethyl(methyl)azanium;tetrafluoroborate has a molecular weight of 204.04 g/mol, XLogP of 2.91, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;triethyl(methyl)azanium;tetrafluoroborate is sourced from PubChem (CID 87302670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).