About tetramethylazanium tetrafluoroborate
tetramethylazanium tetrafluoroborate (PubChem CID 12621) has the molecular formula C4H12BF4N
and a molecular weight of 160.95 g/mol. Its IUPAC name is tetramethylazanium tetrafluoroborate.
Molecular Properties
| Compound Name | tetramethylazanium tetrafluoroborate |
| PubChem CID | 12621 |
| Molecular Formula | C4H12BF4N |
| Molecular Weight | 160.95 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | tetramethylazanium tetrafluoroborate |
| SMILES | C[N+](C)(C)C.F[B-](F)(F)F |
| InChI | InChI=1S/C4H12N.BF4/c1-5(2,3)4;2-1(3,4)5/h1-4H3;/q+1;-1 |
| InChIKey | XWFABLFRYCHILB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.95 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetramethylazanium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetramethylazanium tetrafluoroborate?
The IUPAC name of tetramethylazanium tetrafluoroborate (CID 12621) is tetramethylazanium tetrafluoroborate.
What is the SMILES notation for tetramethylazanium tetrafluoroborate?
The canonical SMILES for tetramethylazanium tetrafluoroborate is C[N+](C)(C)C.F[B-](F)(F)F.
What is the InChIKey of tetramethylazanium tetrafluoroborate?
The InChIKey is XWFABLFRYCHILB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12N.BF4/c1-5(2,3)4;2-1(3,4)5/h1-4H3;/q+1;-1.
What are the key properties of tetramethylazanium tetrafluoroborate?
tetramethylazanium tetrafluoroborate has a molecular weight of 160.95 g/mol, XLogP of 1.62, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetramethylazanium tetrafluoroborate is sourced from PubChem (CID 12621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).