About N,N-dimethylmethanamine;hydron;tetrafluoroborate
N,N-dimethylmethanamine;hydron;tetrafluoroborate (PubChem CID 174246873) has the molecular formula C3H10BF4N
and a molecular weight of 146.92 g/mol. Its IUPAC name is N,N-dimethylmethanamine;hydron;tetrafluoroborate.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;hydron;tetrafluoroborate |
| PubChem CID | 174246873 |
| Molecular Formula | C3H10BF4N |
| Molecular Weight | 146.92 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | N,N-dimethylmethanamine;hydron;tetrafluoroborate |
| SMILES | CN(C)C.F[B-](F)(F)F.[H+] |
| InChI | InChI=1S/C3H9N.BF4/c1-4(2)3;2-1(3,4)5/h1-3H3;/q;-1/p+1 |
| InChIKey | GINZGVYFMFRKDH-UHFFFAOYSA-O |
| XLogP | 1.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.92 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylmethanamine;hydron;tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;hydron;tetrafluoroborate?
The IUPAC name of N,N-dimethylmethanamine;hydron;tetrafluoroborate (CID 174246873) is N,N-dimethylmethanamine;hydron;tetrafluoroborate.
What is the SMILES notation for N,N-dimethylmethanamine;hydron;tetrafluoroborate?
The canonical SMILES for N,N-dimethylmethanamine;hydron;tetrafluoroborate is CN(C)C.F[B-](F)(F)F.[H+].
What is the InChIKey of N,N-dimethylmethanamine;hydron;tetrafluoroborate?
The InChIKey is GINZGVYFMFRKDH-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H9N.BF4/c1-4(2)3;2-1(3,4)5/h1-3H3;/q;-1/p+1.
What are the key properties of N,N-dimethylmethanamine;hydron;tetrafluoroborate?
N,N-dimethylmethanamine;hydron;tetrafluoroborate has a molecular weight of 146.92 g/mol, XLogP of 1.59, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;hydron;tetrafluoroborate is sourced from PubChem (CID 174246873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).