About methanesulfonic acid;triethyl(methyl)azanium
methanesulfonic acid;triethyl(methyl)azanium (PubChem CID 87743130) has the molecular formula C8H22NO3S+
and a molecular weight of 212.33 g/mol. Its IUPAC name is methanesulfonic acid;triethyl(methyl)azanium.
Molecular Properties
| Compound Name | methanesulfonic acid;triethyl(methyl)azanium |
| PubChem CID | 87743130 |
| Molecular Formula | C8H22NO3S+ |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | methanesulfonic acid;triethyl(methyl)azanium |
| SMILES | CC[N+](C)(CC)CC.CS(=O)(=O)O |
| InChI | InChI=1S/C7H18N.CH4O3S/c1-5-8(4,6-2)7-3;1-5(2,3)4/h5-7H2,1-4H3;1H3,(H,2,3,4)/q+1; |
| InChIKey | VQAWBZYRRWFGGQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonic acid;triethyl(methyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonic acid;triethyl(methyl)azanium?
The IUPAC name of methanesulfonic acid;triethyl(methyl)azanium (CID 87743130) is methanesulfonic acid;triethyl(methyl)azanium.
What is the SMILES notation for methanesulfonic acid;triethyl(methyl)azanium?
The canonical SMILES for methanesulfonic acid;triethyl(methyl)azanium is CC[N+](C)(CC)CC.CS(=O)(=O)O.
What is the InChIKey of methanesulfonic acid;triethyl(methyl)azanium?
The InChIKey is VQAWBZYRRWFGGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N.CH4O3S/c1-5-8(4,6-2)7-3;1-5(2,3)4/h5-7H2,1-4H3;1H3,(H,2,3,4)/q+1;.
What are the key properties of methanesulfonic acid;triethyl(methyl)azanium?
methanesulfonic acid;triethyl(methyl)azanium has a molecular weight of 212.33 g/mol, XLogP of 1.00, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonic acid;triethyl(methyl)azanium is sourced from PubChem (CID 87743130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).