About triethyl(methyl)azanium;trifluoro borate;iodide
triethyl(methyl)azanium;trifluoro borate;iodide (PubChem CID 175209505) has the molecular formula C7H18BF3INO3
and a molecular weight of 358.94 g/mol. Its IUPAC name is triethyl(methyl)azanium;trifluoro borate;iodide.
Molecular Properties
| Compound Name | triethyl(methyl)azanium;trifluoro borate;iodide |
| PubChem CID | 175209505 |
| Molecular Formula | C7H18BF3INO3 |
| Molecular Weight | 358.94 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | triethyl(methyl)azanium;trifluoro borate;iodide |
| SMILES | CC[N+](C)(CC)CC.FOB(OF)OF.[I-] |
| InChI | InChI=1S/C7H18N.BF3O3.HI/c1-5-8(4,6-2)7-3;2-5-1(6-3)7-4;/h5-7H2,1-4H3;;1H/q+1;;/p-1 |
| InChIKey | FTQIKXWTYLMRIJ-UHFFFAOYSA-M |
| XLogP | -0.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.94 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze triethyl(methyl)azanium;trifluoro borate;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl(methyl)azanium;trifluoro borate;iodide?
The IUPAC name of triethyl(methyl)azanium;trifluoro borate;iodide (CID 175209505) is triethyl(methyl)azanium;trifluoro borate;iodide.
What is the SMILES notation for triethyl(methyl)azanium;trifluoro borate;iodide?
The canonical SMILES for triethyl(methyl)azanium;trifluoro borate;iodide is CC[N+](C)(CC)CC.FOB(OF)OF.[I-].
What is the InChIKey of triethyl(methyl)azanium;trifluoro borate;iodide?
The InChIKey is FTQIKXWTYLMRIJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H18N.BF3O3.HI/c1-5-8(4,6-2)7-3;2-5-1(6-3)7-4;/h5-7H2,1-4H3;;1H/q+1;;/p-1.
What are the key properties of triethyl(methyl)azanium;trifluoro borate;iodide?
triethyl(methyl)azanium;trifluoro borate;iodide has a molecular weight of 358.94 g/mol, XLogP of -0.83, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl(methyl)azanium;trifluoro borate;iodide is sourced from PubChem (CID 175209505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).