About phenol;triethyl(methyl)azanium
phenol;triethyl(methyl)azanium (PubChem CID 159672401) has the molecular formula C13H24NO+
and a molecular weight of 210.34 g/mol. Its IUPAC name is phenol;triethyl(methyl)azanium.
Molecular Properties
| Compound Name | phenol;triethyl(methyl)azanium |
| PubChem CID | 159672401 |
| Molecular Formula | C13H24NO+ |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.19 |
| IUPAC Name | phenol;triethyl(methyl)azanium |
| SMILES | CC[N+](C)(CC)CC.Oc1ccccc1 |
| InChI | InChI=1S/C7H18N.C6H6O/c1-5-8(4,6-2)7-3;7-6-4-2-1-3-5-6/h5-7H2,1-4H3;1-5,7H/q+1; |
| InChIKey | MUDXEOLNKUNYCA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze phenol;triethyl(methyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenol;triethyl(methyl)azanium?
The IUPAC name of phenol;triethyl(methyl)azanium (CID 159672401) is phenol;triethyl(methyl)azanium.
What is the SMILES notation for phenol;triethyl(methyl)azanium?
The canonical SMILES for phenol;triethyl(methyl)azanium is CC[N+](C)(CC)CC.Oc1ccccc1.
What is the InChIKey of phenol;triethyl(methyl)azanium?
The InChIKey is MUDXEOLNKUNYCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N.C6H6O/c1-5-8(4,6-2)7-3;7-6-4-2-1-3-5-6/h5-7H2,1-4H3;1-5,7H/q+1;.
What are the key properties of phenol;triethyl(methyl)azanium?
phenol;triethyl(methyl)azanium has a molecular weight of 210.34 g/mol, XLogP of 2.88, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenol;triethyl(methyl)azanium is sourced from PubChem (CID 159672401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).