About bromo(trichloro)boranuide;triethyl(methyl)azanium
bromo(trichloro)boranuide;triethyl(methyl)azanium (PubChem CID 140836548) has the molecular formula C7H18BBrCl3N
and a molecular weight of 313.30 g/mol. Its IUPAC name is bromo(trichloro)boranuide;triethyl(methyl)azanium.
Molecular Properties
| Compound Name | bromo(trichloro)boranuide;triethyl(methyl)azanium |
| PubChem CID | 140836548 |
| Molecular Formula | C7H18BBrCl3N |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | bromo(trichloro)boranuide;triethyl(methyl)azanium |
| SMILES | CC[N+](C)(CC)CC.Cl[B-](Cl)(Cl)Br |
| InChI | InChI=1S/C7H18N.BBrCl3/c1-5-8(4,6-2)7-3;2-1(3,4)5/h5-7H2,1-4H3;/q+1;-1 |
| InChIKey | GJVWHTXQXUKIFD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze bromo(trichloro)boranuide;triethyl(methyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromo(trichloro)boranuide;triethyl(methyl)azanium?
The IUPAC name of bromo(trichloro)boranuide;triethyl(methyl)azanium (CID 140836548) is bromo(trichloro)boranuide;triethyl(methyl)azanium.
What is the SMILES notation for bromo(trichloro)boranuide;triethyl(methyl)azanium?
The canonical SMILES for bromo(trichloro)boranuide;triethyl(methyl)azanium is CC[N+](C)(CC)CC.Cl[B-](Cl)(Cl)Br.
What is the InChIKey of bromo(trichloro)boranuide;triethyl(methyl)azanium?
The InChIKey is GJVWHTXQXUKIFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N.BBrCl3/c1-5-8(4,6-2)7-3;2-1(3,4)5/h5-7H2,1-4H3;/q+1;-1.
What are the key properties of bromo(trichloro)boranuide;triethyl(methyl)azanium?
bromo(trichloro)boranuide;triethyl(methyl)azanium has a molecular weight of 313.30 g/mol, XLogP of 4.03, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bromo(trichloro)boranuide;triethyl(methyl)azanium is sourced from PubChem (CID 140836548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).