C6H17ClNO5+ — CID 87344465
2-hydroxypropyl(trimethyl)azanium;perchloric acid (PubChem CID 87344465) has the molecular formula C6H17ClNO5+ and a molecular weight of 218.66 g/mol. Its IUPAC name is 2-hydroxypropyl(trimethyl)azanium;perchloric acid.
| Compound Name | 2-hydroxypropyl(trimethyl)azanium;perchloric acid |
|---|---|
| PubChem CID | 87344465 |
| Molecular Formula | C6H17ClNO5+ |
| Molecular Weight | 218.66 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 2-hydroxypropyl(trimethyl)azanium;perchloric acid |
| SMILES | CC(O)C[N+](C)(C)C.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C6H16NO.ClHO4/c1-6(8)5-7(2,3)4;2-1(3,4)5/h6,8H,5H2,1-4H3;(H,2,3,4,5)/q+1; |
| InChIKey | RDBPQFAKBGZJDD-UHFFFAOYSA-N |
| XLogP | -4.05 |
| TPSA | 109.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.66 |
| LogP ≤ 5 | -4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|