C7H18NO4+ — CID 174974136
carbonic acid;2-hydroxypropyl(trimethyl)azanium (PubChem CID 174974136) has the molecular formula C7H18NO4+ and a molecular weight of 180.22 g/mol. Its IUPAC name is carbonic acid;2-hydroxypropyl(trimethyl)azanium.
| Compound Name | carbonic acid;2-hydroxypropyl(trimethyl)azanium |
|---|---|
| PubChem CID | 174974136 |
| Molecular Formula | C7H18NO4+ |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | carbonic acid;2-hydroxypropyl(trimethyl)azanium |
| SMILES | CC(O)C[N+](C)(C)C.O=C(O)O |
| InChI | InChI=1S/C6H16NO.CH2O3/c1-6(8)5-7(2,3)4;2-1(3)4/h6,8H,5H2,1-4H3;(H2,2,3,4)/q+1; |
| InChIKey | SVUJMCAUPHQIOU-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|