C10H22ClNO3 — CID 175459038
2-hydroxypropyl(trimethyl)azanium;2-methylprop-2-enoate;hydrochloride (PubChem CID 175459038) has the molecular formula C10H22ClNO3 and a molecular weight of 239.74 g/mol. Its IUPAC name is 2-hydroxypropyl(trimethyl)azanium;2-methylprop-2-enoate;hydrochloride.
| Compound Name | 2-hydroxypropyl(trimethyl)azanium;2-methylprop-2-enoate;hydrochloride |
|---|---|
| PubChem CID | 175459038 |
| Molecular Formula | C10H22ClNO3 |
| Molecular Weight | 239.74 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 2-hydroxypropyl(trimethyl)azanium;2-methylprop-2-enoate;hydrochloride |
| SMILES | C=C(C)C(=O)[O-].CC(O)C[N+](C)(C)C.Cl |
| InChI | InChI=1S/C6H16NO.C4H6O2.ClH/c1-6(8)5-7(2,3)4;1-3(2)4(5)6;/h6,8H,5H2,1-4H3;1H2,2H3,(H,5,6);1H/q+1;;/p-1 |
| InChIKey | SMNMHKFIYRHKPP-UHFFFAOYSA-M |
| XLogP | -0.19 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.74 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|