C8H19Cl2NO3 — CID 21150043
(3-chloro-2-hydroxypropyl)-trimethylazanium;acetate;hydrochloride (PubChem CID 21150043) has the molecular formula C8H19Cl2NO3 and a molecular weight of 248.15 g/mol. Its IUPAC name is (3-chloro-2-hydroxypropyl)-trimethylazanium;acetate;hydrochloride.
| Compound Name | (3-chloro-2-hydroxypropyl)-trimethylazanium;acetate;hydrochloride |
|---|---|
| PubChem CID | 21150043 |
| Molecular Formula | C8H19Cl2NO3 |
| Molecular Weight | 248.15 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | (3-chloro-2-hydroxypropyl)-trimethylazanium;acetate;hydrochloride |
| SMILES | CC(=O)[O-].C[N+](C)(C)CC(O)CCl.Cl |
| InChI | InChI=1S/C6H15ClNO.C2H4O2.ClH/c1-8(2,3)5-6(9)4-7;1-2(3)4;/h6,9H,4-5H2,1-3H3;1H3,(H,3,4);1H/q+1;;/p-1 |
| InChIKey | QWWTVENTIAXHSZ-UHFFFAOYSA-M |
| XLogP | -0.53 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.15 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|