C14H32Cl2N2O2+2 — CID 57185651
(3-chloro-2-hydroxypropyl)-[4-[(3-chloro-2-hydroxypropyl)-dimethylazaniumyl]butyl]-dimethylazanium (PubChem CID 57185651) has the molecular formula C14H32Cl2N2O2+2 and a molecular weight of 331.33 g/mol. Its IUPAC name is (3-chloro-2-hydroxypropyl)-[4-[(3-chloro-2-hydroxypropyl)-dimethylazaniumyl]butyl]-dimethylazanium.
| Compound Name | (3-chloro-2-hydroxypropyl)-[4-[(3-chloro-2-hydroxypropyl)-dimethylazaniumyl]butyl]-dimethylazanium |
|---|---|
| PubChem CID | 57185651 |
| Molecular Formula | C14H32Cl2N2O2+2 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (3-chloro-2-hydroxypropyl)-[4-[(3-chloro-2-hydroxypropyl)-dimethylazaniumyl]butyl]-dimethylazanium |
| SMILES | C[N+](C)(CCCC[N+](C)(C)CC(O)CCl)CC(O)CCl |
| InChI | InChI=1S/C14H32Cl2N2O2/c1-17(2,11-13(19)9-15)7-5-6-8-18(3,4)12-14(20)10-16/h13-14,19-20H,5-12H2,1-4H3/q+2 |
| InChIKey | QVVDAPBOYPNZMJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|