C7H15NO4 — CID 74335503
2,3-dihydroxy-4-(trimethylazaniumyl)butanoate (PubChem CID 74335503) has the molecular formula C7H15NO4 and a molecular weight of 177.20 g/mol. Its IUPAC name is 2,3-dihydroxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 2,3-dihydroxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 74335503 |
| Molecular Formula | C7H15NO4 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 2,3-dihydroxy-4-(trimethylazaniumyl)butanoate |
| SMILES | C[N+](C)(C)CC(O)C(O)C(=O)[O-] |
| InChI | InChI=1S/C7H15NO4/c1-8(2,3)4-5(9)6(10)7(11)12/h5-6,9-10H,4H2,1-3H3 |
| InChIKey | ZOPACRMLVDFSGJ-UHFFFAOYSA-N |
| XLogP | -2.84 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|