C18H30N2O8 — CID 140897773
(E)-2,7-bis[1-hydroxy-2-(trimethylazaniumyl)ethyl]-3,6-dioxooct-4-enedioate (PubChem CID 140897773) has the molecular formula C18H30N2O8 and a molecular weight of 402.44 g/mol. Its IUPAC name is (E)-2,7-bis[1-hydroxy-2-(trimethylazaniumyl)ethyl]-3,6-dioxooct-4-enedioate.
| Compound Name | (E)-2,7-bis[1-hydroxy-2-(trimethylazaniumyl)ethyl]-3,6-dioxooct-4-enedioate |
|---|---|
| PubChem CID | 140897773 |
| Molecular Formula | C18H30N2O8 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | (E)-2,7-bis[1-hydroxy-2-(trimethylazaniumyl)ethyl]-3,6-dioxooct-4-enedioate |
| SMILES | C[N+](C)(C)CC(O)C(C(=O)[O-])C(=O)/C=C/C(=O)C(C(=O)[O-])C(O)C[N+](C)(C)C |
| InChI | InChI=1S/C18H30N2O8/c1-19(2,3)9-13(23)15(17(25)26)11(21)7-8-12(22)16(18(27)28)14(24)10-20(4,5)6/h7-8,13-16,23-24H,9-10H2,1-6H3/b8-7+ |
| InChIKey | VOKFHXSHJFITEU-BQYQJAHWSA-N |
| XLogP | -4.45 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | -4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|