C25H48NO5+ — CID 171905994
[(Z)-3-carboxy-2,13-dihydroxy-4-oxohenicos-5-enyl]-trimethylazanium (PubChem CID 171905994) has the molecular formula C25H48NO5+ and a molecular weight of 442.66 g/mol. Its IUPAC name is [(Z)-3-carboxy-2,13-dihydroxy-4-oxohenicos-5-enyl]-trimethylazanium.
| Compound Name | [(Z)-3-carboxy-2,13-dihydroxy-4-oxohenicos-5-enyl]-trimethylazanium |
|---|---|
| PubChem CID | 171905994 |
| Molecular Formula | C25H48NO5+ |
| Molecular Weight | 442.66 g/mol |
| Exact Mass | 442.35 |
| IUPAC Name | [(Z)-3-carboxy-2,13-dihydroxy-4-oxohenicos-5-enyl]-trimethylazanium |
| SMILES | CCCCCCCCC(O)CCCCCC/C=C\C(=O)C(C(=O)O)C(O)C[N+](C)(C)C |
| InChI | InChI=1S/C25H47NO5/c1-5-6-7-8-11-14-17-21(27)18-15-12-9-10-13-16-19-22(28)24(25(30)31)23(29)20-26(2,3)4/h16,19,21,23-24,27,29H,5-15,17-18,20H2,1-4H3/p+1/b19-16- |
| InChIKey | MJLYSLOXZJBPEY-MNDPQUGUSA-O |
| XLogP | 4.33 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.66 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|