C25H46Cl2NO4+ — CID 98117370
[(Z,2S,3R,12S,13S)-3-carboxy-12,13-dichloro-2-hydroxy-4-oxohenicos-15-enyl]-trimethylazanium (PubChem CID 98117370) has the molecular formula C25H46Cl2NO4+ and a molecular weight of 495.55 g/mol. Its IUPAC name is [(Z,2S,3R,12S,13S)-3-carboxy-12,13-dichloro-2-hydroxy-4-oxohenicos-15-enyl]-trimethylazanium.
| Compound Name | [(Z,2S,3R,12S,13S)-3-carboxy-12,13-dichloro-2-hydroxy-4-oxohenicos-15-enyl]-trimethylazanium |
|---|---|
| PubChem CID | 98117370 |
| Molecular Formula | C25H46Cl2NO4+ |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | [(Z,2S,3R,12S,13S)-3-carboxy-12,13-dichloro-2-hydroxy-4-oxohenicos-15-enyl]-trimethylazanium |
| SMILES | CCCCC/C=C\C[C@H](Cl)[C@@H](Cl)CCCCCCCC(=O)[C@H](C(=O)O)[C@H](O)C[N+](C)(C)C |
| InChI | InChI=1S/C25H45Cl2NO4/c1-5-6-7-8-10-13-16-20(26)21(27)17-14-11-9-12-15-18-22(29)24(25(31)32)23(30)19-28(2,3)4/h10,13,20-21,23-24,30H,5-9,11-12,14-19H2,1-4H3/p+1/b13-10-/t20-,21-,23+,24-/m0/s1 |
| InChIKey | WZOYZEOQYHNNJM-LAKJLWEBSA-O |
| XLogP | 5.80 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|