C12H24NO4+ — CID 124825802
[(2R,3R,5S)-3-carboxy-2-hydroxy-5-methyl-4-oxoheptyl]-trimethylazanium (PubChem CID 124825802) has the molecular formula C12H24NO4+ and a molecular weight of 246.33 g/mol. Its IUPAC name is [(2R,3R,5S)-3-carboxy-2-hydroxy-5-methyl-4-oxoheptyl]-trimethylazanium.
| Compound Name | [(2R,3R,5S)-3-carboxy-2-hydroxy-5-methyl-4-oxoheptyl]-trimethylazanium |
|---|---|
| PubChem CID | 124825802 |
| Molecular Formula | C12H24NO4+ |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | [(2R,3R,5S)-3-carboxy-2-hydroxy-5-methyl-4-oxoheptyl]-trimethylazanium |
| SMILES | CC[C@H](C)C(=O)[C@H](C(=O)O)[C@@H](O)C[N+](C)(C)C |
| InChI | InChI=1S/C12H23NO4/c1-6-8(2)11(15)10(12(16)17)9(14)7-13(3,4)5/h8-10,14H,6-7H2,1-5H3/p+1/t8-,9-,10+/m0/s1 |
| InChIKey | PCWRFOSQWKEJCP-LPEHRKFASA-O |
| XLogP | 0.37 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|