C18H34N2O8S+2 — CID 140839360
[3,8-dicarboxy-2,9-dihydroxy-4,7-dioxo-5-sulfanyl-10-(trimethylazaniumyl)decyl]-trimethylazanium (PubChem CID 140839360) has the molecular formula C18H34N2O8S+2 and a molecular weight of 438.54 g/mol. Its IUPAC name is [3,8-dicarboxy-2,9-dihydroxy-4,7-dioxo-5-sulfanyl-10-(trimethylazaniumyl)decyl]-trimethylazanium.
| Compound Name | [3,8-dicarboxy-2,9-dihydroxy-4,7-dioxo-5-sulfanyl-10-(trimethylazaniumyl)decyl]-trimethylazanium |
|---|---|
| PubChem CID | 140839360 |
| Molecular Formula | C18H34N2O8S+2 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | [3,8-dicarboxy-2,9-dihydroxy-4,7-dioxo-5-sulfanyl-10-(trimethylazaniumyl)decyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(O)C(C(=O)O)C(=O)CC(S)C(=O)C(C(=O)O)C(O)C[N+](C)(C)C |
| InChI | InChI=1S/C18H32N2O8S/c1-19(2,3)8-11(22)14(17(25)26)10(21)7-13(29)16(24)15(18(27)28)12(23)9-20(4,5)6/h11-15,22-23H,7-9H2,1-6H3,(H-2,25,26,27,28,29)/p+2 |
| InChIKey | AAHMGUYMOBRTNJ-UHFFFAOYSA-P |
| XLogP | -1.65 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|