C9H18NO3+ — CID 88740584
(2,3-dihydroxy-4-oxohex-5-enyl)-trimethylazanium (PubChem CID 88740584) has the molecular formula C9H18NO3+ and a molecular weight of 188.25 g/mol. Its IUPAC name is (2,3-dihydroxy-4-oxohex-5-enyl)-trimethylazanium.
| Compound Name | (2,3-dihydroxy-4-oxohex-5-enyl)-trimethylazanium |
|---|---|
| PubChem CID | 88740584 |
| Molecular Formula | C9H18NO3+ |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (2,3-dihydroxy-4-oxohex-5-enyl)-trimethylazanium |
| SMILES | C=CC(=O)C(O)C(O)C[N+](C)(C)C |
| InChI | InChI=1S/C9H18NO3/c1-5-7(11)9(13)8(12)6-10(2,3)4/h5,8-9,12-13H,1,6H2,2-4H3/q+1 |
| InChIKey | OWJNTGRXRFDEPS-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|