C12H22O4 — CID 174551719
6-hexoxy-4,5-dihydroxyhex-1-en-3-one (PubChem CID 174551719) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is 6-hexoxy-4,5-dihydroxyhex-1-en-3-one.
| Compound Name | 6-hexoxy-4,5-dihydroxyhex-1-en-3-one |
|---|---|
| PubChem CID | 174551719 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 6-hexoxy-4,5-dihydroxyhex-1-en-3-one |
| SMILES | C=CC(=O)C(O)C(O)COCCCCCC |
| InChI | InChI=1S/C12H22O4/c1-3-5-6-7-8-16-9-11(14)12(15)10(13)4-2/h4,11-12,14-15H,2-3,5-9H2,1H3 |
| InChIKey | ZCYKYOYTMODTTH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|