About 1-pentoxyoctane-2,3-diol
1-pentoxyoctane-2,3-diol (PubChem CID 88758443) has the molecular formula C13H28O3
and a molecular weight of 232.36 g/mol. Its IUPAC name is 1-pentoxyoctane-2,3-diol.
Molecular Properties
| Compound Name | 1-pentoxyoctane-2,3-diol |
| PubChem CID | 88758443 |
| Molecular Formula | C13H28O3 |
| Molecular Weight | 232.36 g/mol |
| Exact Mass | 232.20 |
| IUPAC Name | 1-pentoxyoctane-2,3-diol |
| SMILES | CCCCCOCC(O)C(O)CCCCC |
| InChI | InChI=1S/C13H28O3/c1-3-5-7-9-12(14)13(15)11-16-10-8-6-4-2/h12-15H,3-11H2,1-2H3 |
| InChIKey | AKUOXMUXPLPRNF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-pentoxyoctane-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentoxyoctane-2,3-diol?
The IUPAC name of 1-pentoxyoctane-2,3-diol (CID 88758443) is 1-pentoxyoctane-2,3-diol.
What is the SMILES notation for 1-pentoxyoctane-2,3-diol?
The canonical SMILES for 1-pentoxyoctane-2,3-diol is CCCCCOCC(O)C(O)CCCCC.
What is the InChIKey of 1-pentoxyoctane-2,3-diol?
The InChIKey is AKUOXMUXPLPRNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O3/c1-3-5-7-9-12(14)13(15)11-16-10-8-6-4-2/h12-15H,3-11H2,1-2H3.
What are the key properties of 1-pentoxyoctane-2,3-diol?
1-pentoxyoctane-2,3-diol has a molecular weight of 232.36 g/mol, XLogP of 2.50, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentoxyoctane-2,3-diol is sourced from PubChem (CID 88758443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).