C20H42O5 — CID 91000275
1-(5,6-dihydroxydecoxy)decane-5,6-diol (PubChem CID 91000275) has the molecular formula C20H42O5 and a molecular weight of 362.55 g/mol. Its IUPAC name is 1-(5,6-dihydroxydecoxy)decane-5,6-diol.
| Compound Name | 1-(5,6-dihydroxydecoxy)decane-5,6-diol |
|---|---|
| PubChem CID | 91000275 |
| Molecular Formula | C20H42O5 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.30 |
| IUPAC Name | 1-(5,6-dihydroxydecoxy)decane-5,6-diol |
| SMILES | CCCCC(O)C(O)CCCCOCCCCC(O)C(O)CCCC |
| InChI | InChI=1S/C20H42O5/c1-3-5-11-17(21)19(23)13-7-9-15-25-16-10-8-14-20(24)18(22)12-6-4-2/h17-24H,3-16H2,1-2H3 |
| InChIKey | LNJZKBHVMRYJLS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|