C12H18O7 — CID 174301593
6-(2,3-dihydroxy-4-oxohex-5-enoxy)-4,5-dihydroxyhex-1-en-3-one (PubChem CID 174301593) has the molecular formula C12H18O7 and a molecular weight of 274.27 g/mol. Its IUPAC name is 6-(2,3-dihydroxy-4-oxohex-5-enoxy)-4,5-dihydroxyhex-1-en-3-one.
| Compound Name | 6-(2,3-dihydroxy-4-oxohex-5-enoxy)-4,5-dihydroxyhex-1-en-3-one |
|---|---|
| PubChem CID | 174301593 |
| Molecular Formula | C12H18O7 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 6-(2,3-dihydroxy-4-oxohex-5-enoxy)-4,5-dihydroxyhex-1-en-3-one |
| SMILES | C=CC(=O)C(O)C(O)COCC(O)C(O)C(=O)C=C |
| InChI | InChI=1S/C12H18O7/c1-3-7(13)11(17)9(15)5-19-6-10(16)12(18)8(14)4-2/h3-4,9-12,15-18H,1-2,5-6H2 |
| InChIKey | CUEDWCNTQAUZLL-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|