C8H15NO5 — CID 88892230
N-(2,3,4-trihydroxybutoxymethyl)prop-2-enamide (PubChem CID 88892230) has the molecular formula C8H15NO5 and a molecular weight of 205.21 g/mol. Its IUPAC name is N-(2,3,4-trihydroxybutoxymethyl)prop-2-enamide.
| Compound Name | N-(2,3,4-trihydroxybutoxymethyl)prop-2-enamide |
|---|---|
| PubChem CID | 88892230 |
| Molecular Formula | C8H15NO5 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | N-(2,3,4-trihydroxybutoxymethyl)prop-2-enamide |
| SMILES | C=CC(=O)NCOCC(O)C(O)CO |
| InChI | InChI=1S/C8H15NO5/c1-2-8(13)9-5-14-4-7(12)6(11)3-10/h2,6-7,10-12H,1,3-5H2,(H,9,13) |
| InChIKey | YTKSMEJLRDDHTE-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|