C15H29NO7 — CID 118421966
N-[2,3-dimethyl-4-(2,3,4,5,6-pentahydroxyhexoxy)butyl]prop-2-enamide (PubChem CID 118421966) has the molecular formula C15H29NO7 and a molecular weight of 335.40 g/mol. Its IUPAC name is N-[2,3-dimethyl-4-(2,3,4,5,6-pentahydroxyhexoxy)butyl]prop-2-enamide.
| Compound Name | N-[2,3-dimethyl-4-(2,3,4,5,6-pentahydroxyhexoxy)butyl]prop-2-enamide |
|---|---|
| PubChem CID | 118421966 |
| Molecular Formula | C15H29NO7 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | N-[2,3-dimethyl-4-(2,3,4,5,6-pentahydroxyhexoxy)butyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC(C)C(C)COCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C15H29NO7/c1-4-13(20)16-5-9(2)10(3)7-23-8-12(19)15(22)14(21)11(18)6-17/h4,9-12,14-15,17-19,21-22H,1,5-8H2,2-3H3,(H,16,20) |
| InChIKey | WDEMDIFELCBFRU-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|