C15H30O13 — CID 123514197
[2,3,4,5-tetrahydroxy-6-(2,3,4,5,6-pentahydroxyhexoxymethoxy)hexyl] acetate (PubChem CID 123514197) has the molecular formula C15H30O13 and a molecular weight of 418.39 g/mol. Its IUPAC name is [2,3,4,5-tetrahydroxy-6-(2,3,4,5,6-pentahydroxyhexoxymethoxy)hexyl] acetate.
| Compound Name | [2,3,4,5-tetrahydroxy-6-(2,3,4,5,6-pentahydroxyhexoxymethoxy)hexyl] acetate |
|---|---|
| PubChem CID | 123514197 |
| Molecular Formula | C15H30O13 |
| Molecular Weight | 418.39 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | [2,3,4,5-tetrahydroxy-6-(2,3,4,5,6-pentahydroxyhexoxymethoxy)hexyl] acetate |
| SMILES | CC(=O)OCC(O)C(O)C(O)C(O)COCOCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C15H30O13/c1-7(17)28-5-11(21)15(25)14(24)10(20)4-27-6-26-3-9(19)13(23)12(22)8(18)2-16/h8-16,18-25H,2-6H2,1H3 |
| InChIKey | ZAHYGWZWHBHPPH-UHFFFAOYSA-N |
| XLogP | -5.58 |
| TPSA | 226.83 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.39 |
| LogP ≤ 5 | -5.58 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|