C13H26O11 — CID 87468403
(2-acetyloxy-3-hydroxypropyl) acetate;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol (PubChem CID 87468403) has the molecular formula C13H26O11 and a molecular weight of 358.34 g/mol. Its IUPAC name is (2-acetyloxy-3-hydroxypropyl) acetate;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol.
| Compound Name | (2-acetyloxy-3-hydroxypropyl) acetate;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 87468403 |
| Molecular Formula | C13H26O11 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (2-acetyloxy-3-hydroxypropyl) acetate;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol |
| SMILES | CC(=O)OCC(CO)OC(C)=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C7H12O5.C6H14O6/c1-5(9)11-4-7(3-8)12-6(2)10;7-1-3(9)5(11)6(12)4(10)2-8/h7-8H,3-4H2,1-2H3;3-12H,1-2H2/t;3-,4+,5-,6-/m.1/s1 |
| InChIKey | KPKORSASWGLBLS-VCDGYCQFSA-N |
| XLogP | -4.11 |
| TPSA | 194.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | -4.11 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |