C10H20O8 — CID 166926018
[(2S,3S,4S,5S)-2,3,4,5,6-pentahydroxyhexyl] 3-hydroxybutanoate (PubChem CID 166926018) has the molecular formula C10H20O8 and a molecular weight of 268.26 g/mol. Its IUPAC name is [(2S,3S,4S,5S)-2,3,4,5,6-pentahydroxyhexyl] 3-hydroxybutanoate.
| Compound Name | [(2S,3S,4S,5S)-2,3,4,5,6-pentahydroxyhexyl] 3-hydroxybutanoate |
|---|---|
| PubChem CID | 166926018 |
| Molecular Formula | C10H20O8 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | [(2S,3S,4S,5S)-2,3,4,5,6-pentahydroxyhexyl] 3-hydroxybutanoate |
| SMILES | CC(O)CC(=O)OC[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C10H20O8/c1-5(12)2-8(15)18-4-7(14)10(17)9(16)6(13)3-11/h5-7,9-14,16-17H,2-4H2,1H3/t5?,6-,7-,9-,10-/m0/s1 |
| InChIKey | UYJDTOAPMRRTRM-YYBXZTIXSA-N |
| XLogP | -3.26 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |