C10H18O8 — CID 87838346
[(3R,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] 3-hydroxybutanoate (PubChem CID 87838346) has the molecular formula C10H18O8 and a molecular weight of 266.25 g/mol. Its IUPAC name is [(3R,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] 3-hydroxybutanoate.
| Compound Name | [(3R,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] 3-hydroxybutanoate |
|---|---|
| PubChem CID | 87838346 |
| Molecular Formula | C10H18O8 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | [(3R,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] 3-hydroxybutanoate |
| SMILES | CC(O)CC(=O)OCC(=O)[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H18O8/c1-5(12)2-8(15)18-4-7(14)10(17)9(16)6(13)3-11/h5-6,9-13,16-17H,2-4H2,1H3/t5?,6-,9+,10+/m1/s1 |
| InChIKey | BZYINYRMGDEVGY-ORPLZSCASA-N |
| XLogP | -3.06 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |