C7H15NO5 — CID 14806557
(3S,4R,5R)-3,4,5,6-tetrahydroxy-1-(methylamino)hexan-2-one (PubChem CID 14806557) has the molecular formula C7H15NO5 and a molecular weight of 193.20 g/mol. Its IUPAC name is (3S,4R,5R)-3,4,5,6-tetrahydroxy-1-(methylamino)hexan-2-one.
| Compound Name | (3S,4R,5R)-3,4,5,6-tetrahydroxy-1-(methylamino)hexan-2-one |
|---|---|
| PubChem CID | 14806557 |
| Molecular Formula | C7H15NO5 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | (3S,4R,5R)-3,4,5,6-tetrahydroxy-1-(methylamino)hexan-2-one |
| SMILES | CNCC(=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H15NO5/c1-8-2-4(10)6(12)7(13)5(11)3-9/h5-9,11-13H,2-3H2,1H3/t5-,6-,7-/m1/s1 |
| InChIKey | KJPUOMSDQAYQLZ-FSDSQADBSA-N |
| XLogP | -3.15 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |