C7H13O10P-2 — CID 134820516
[(3S,4R,5R,6R)-3,4,5,6,7-pentahydroxy-2-oxoheptyl] phosphate (PubChem CID 134820516) has the molecular formula C7H13O10P-2 and a molecular weight of 288.15 g/mol. Its IUPAC name is [(3S,4R,5R,6R)-3,4,5,6,7-pentahydroxy-2-oxoheptyl] phosphate.
| Compound Name | [(3S,4R,5R,6R)-3,4,5,6,7-pentahydroxy-2-oxoheptyl] phosphate |
|---|---|
| PubChem CID | 134820516 |
| Molecular Formula | C7H13O10P-2 |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | [(3S,4R,5R,6R)-3,4,5,6,7-pentahydroxy-2-oxoheptyl] phosphate |
| SMILES | O=C(COP(=O)([O-])[O-])[C@@H](O)[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H15O10P/c8-1-3(9)5(11)7(13)6(12)4(10)2-17-18(14,15)16/h3,5-9,11-13H,1-2H2,(H2,14,15,16)/p-2/t3-,5-,6-,7-/m1/s1 |
| InChIKey | JPTRNFAYXMBCLJ-SHUUEZRQSA-L |
| XLogP | -5.16 |
| TPSA | 190.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | -5.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|