C6H11O8P-2 — CID 25245598
[(3R,4R,5R)-3,4,5-trihydroxy-2-oxohexyl] phosphate (PubChem CID 25245598) has the molecular formula C6H11O8P-2 and a molecular weight of 242.12 g/mol. Its IUPAC name is [(3R,4R,5R)-3,4,5-trihydroxy-2-oxohexyl] phosphate.
| Compound Name | [(3R,4R,5R)-3,4,5-trihydroxy-2-oxohexyl] phosphate |
|---|---|
| PubChem CID | 25245598 |
| Molecular Formula | C6H11O8P-2 |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | [(3R,4R,5R)-3,4,5-trihydroxy-2-oxohexyl] phosphate |
| SMILES | C[C@@H](O)[C@@H](O)[C@@H](O)C(=O)COP(=O)([O-])[O-] |
| InChI | InChI=1S/C6H13O8P/c1-3(7)5(9)6(10)4(8)2-14-15(11,12)13/h3,5-7,9-10H,2H2,1H3,(H2,11,12,13)/p-2/t3-,5-,6+/m1/s1 |
| InChIKey | KNYGWWDTPGSEPD-PUFIMZNGSA-L |
| XLogP | -3.50 |
| TPSA | 150.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|