C6H11Na2O9P — CID 154703741
disodium;[(2S,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanoyl] phosphate (PubChem CID 154703741) has the molecular formula C6H11Na2O9P and a molecular weight of 304.10 g/mol. Its IUPAC name is disodium;[(2S,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanoyl] phosphate.
| Compound Name | disodium;[(2S,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanoyl] phosphate |
|---|---|
| PubChem CID | 154703741 |
| Molecular Formula | C6H11Na2O9P |
| Molecular Weight | 304.10 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | disodium;[(2S,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanoyl] phosphate |
| SMILES | C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)OP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C6H13O9P.2Na/c1-2(7)3(8)4(9)5(10)6(11)15-16(12,13)14;;/h2-5,7-10H,1H3,(H2,12,13,14);;/q;2*+1/p-2/t2-,3+,4+,5-;;/m0../s1 |
| InChIKey | JQKUFGHFOLJBBD-RNKDVVNVSA-L |
| XLogP | -10.17 |
| TPSA | 170.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.10 |
| LogP ≤ 5 | -10.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|