C6H14NO9P — CID 87093612
phosphono (2R,3S,4R,5R)-6-amino-2,3,4,5-tetrahydroxyhexanoate (PubChem CID 87093612) has the molecular formula C6H14NO9P and a molecular weight of 275.15 g/mol. Its IUPAC name is phosphono (2R,3S,4R,5R)-6-amino-2,3,4,5-tetrahydroxyhexanoate.
| Compound Name | phosphono (2R,3S,4R,5R)-6-amino-2,3,4,5-tetrahydroxyhexanoate |
|---|---|
| PubChem CID | 87093612 |
| Molecular Formula | C6H14NO9P |
| Molecular Weight | 275.15 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | phosphono (2R,3S,4R,5R)-6-amino-2,3,4,5-tetrahydroxyhexanoate |
| SMILES | NC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)OP(=O)(O)O |
| InChI | InChI=1S/C6H14NO9P/c7-1-2(8)3(9)4(10)5(11)6(12)16-17(13,14)15/h2-5,8-11H,1,7H2,(H2,13,14,15)/t2-,3-,4+,5-/m1/s1 |
| InChIKey | WMLVBDRFQCYNGZ-SQOUGZDYSA-N |
| XLogP | -3.98 |
| TPSA | 190.77 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.15 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|